C-NH-Boc-C-Bis-(C1-PEG1-PFP)
97%
- Product Code: 106134
CAS:
1807521-01-2
| Molecular Weight: | 667.45 g./mol | Molecular Formula: | C₂₆H₂₃F₁₀NO₈ |
|---|---|---|---|
| EC Number: | MDL Number: | MFCD28385477 | |
| Melting Point: | Boiling Point: | ||
| Density: | Storage Condition: | 2-8°C, dry, sealed |
Product Description:
This compound is widely used in peptide synthesis as a protecting group for amines. The Boc group ensures selective protection of the amine functionality during complex reactions, preventing unwanted side reactions. The inclusion of PEG (polyethylene glycol) enhances solubility in various solvents, making it suitable for diverse reaction conditions. The PFP (pentafluorophenyl) ester moiety acts as an efficient activating group, facilitating amide bond formation in peptide coupling reactions. Its design allows for efficient deprotection under mild acidic conditions, ensuring minimal disruption to the peptide structure. This makes it particularly valuable in the synthesis of complex peptides and proteins, where precision and control over reaction conditions are critical. Additionally, its stability and reactivity profile make it a preferred choice in solid-phase peptide synthesis (SPPS), enabling the production of high-purity peptides for pharmaceutical and biochemical research.
Sizes / Availability / Pricing:
| Size (g) | Availability | Price | Quantity |
|---|---|---|---|
| 0.250 | 10-20 days | $3,635.01 |
+
-
|
C-NH-Boc-C-Bis-(C1-PEG1-PFP)
This compound is widely used in peptide synthesis as a protecting group for amines. The Boc group ensures selective protection of the amine functionality during complex reactions, preventing unwanted side reactions. The inclusion of PEG (polyethylene glycol) enhances solubility in various solvents, making it suitable for diverse reaction conditions. The PFP (pentafluorophenyl) ester moiety acts as an efficient activating group, facilitating amide bond formation in peptide coupling reactions. Its design allows for efficient deprotection under mild acidic conditions, ensuring minimal disruption to the peptide structure. This makes it particularly valuable in the synthesis of complex peptides and proteins, where precision and control over reaction conditions are critical. Additionally, its stability and reactivity profile make it a preferred choice in solid-phase peptide synthesis (SPPS), enabling the production of high-purity peptides for pharmaceutical and biochemical research.
| Mechanism | - |
| Appearance | - |
| Longevity | - |
| Strength | - |
| Storage | - |
| Shelf Life | - |
| Allergen(s) | - |
| Dosage (Range) | - |
| Recommended Dosage | - |
| Dosage (Per Day) | - |
| Recommended Dosage (Per Day) | - |
| Mix Method | - |
| Heat Resistance | - |
| Stable in pH range | - |
| Solubility | - |
| Product Types | - |
| INCI | - |
Cart
No products
Subtotal:
$0.00
$0.00
Total :