Ph-Bis(C1-N-(C2-NH-Boc)2)
95%
- Product Code: 55535
CAS:
1807521-06-7
| Molecular Weight: | 708.93 g./mol | Molecular Formula: | C₃₆H₆₄N₆O₈ |
|---|---|---|---|
| EC Number: | MDL Number: | MFCD28142457 | |
| Melting Point: | Boiling Point: | ||
| Density: | Storage Condition: | 2-8°C, dry, sealed |
Product Description:
This chemical is primarily utilized in the synthesis of complex organic molecules, particularly in peptide and protein chemistry. It serves as a key intermediate in the preparation of protected amino acid derivatives, which are essential for solid-phase peptide synthesis (SPPS). The Boc (tert-butoxycarbonyl) protecting groups in the structure play a crucial role in safeguarding amine functionalities during multi-step synthetic processes, ensuring selective reactions and preventing unwanted side reactions. Additionally, it is employed in the development of pharmaceuticals and bioactive compounds, where precise control over molecular structure is critical. Its application extends to research in medicinal chemistry, enabling the creation of novel drug candidates and therapeutic agents.
Sizes / Availability / Pricing:
| Size (g) | Availability | Price | Quantity |
|---|---|---|---|
| 0.100 | 10-20 days | $570.61 |
+
-
|
Ph-Bis(C1-N-(C2-NH-Boc)2)
This chemical is primarily utilized in the synthesis of complex organic molecules, particularly in peptide and protein chemistry. It serves as a key intermediate in the preparation of protected amino acid derivatives, which are essential for solid-phase peptide synthesis (SPPS). The Boc (tert-butoxycarbonyl) protecting groups in the structure play a crucial role in safeguarding amine functionalities during multi-step synthetic processes, ensuring selective reactions and preventing unwanted side reactions. Additionally, it is employed in the development of pharmaceuticals and bioactive compounds, where precise control over molecular structure is critical. Its application extends to research in medicinal chemistry, enabling the creation of novel drug candidates and therapeutic agents.
| Mechanism | - |
| Appearance | - |
| Longevity | - |
| Strength | - |
| Storage | - |
| Shelf Life | - |
| Allergen(s) | - |
| Dosage (Range) | - |
| Recommended Dosage | - |
| Dosage (Per Day) | - |
| Recommended Dosage (Per Day) | - |
| Mix Method | - |
| Heat Resistance | - |
| Stable in pH range | - |
| Solubility | - |
| Product Types | - |
| INCI | - |
Cart
No products
Subtotal:
$0.00
$0.00
Total :