1,1'-[(1R)-6,6'-Dimethoxy[1,1'-biphenyl]-2,2'-diyl]bis[1,1-bis(4-chlorophenyl)phosphine]
98%
- Product Code: 65720
CAS:
1310054-04-6
| Molecular Weight: | 720.4 g./mol | Molecular Formula: | C₃₈H₂₈Cl₄O₂P₂ |
|---|---|---|---|
| EC Number: | MDL Number: | ||
| Melting Point: | Boiling Point: | ||
| Density: | Storage Condition: | 2-8°C |
Product Description:
This chemical is primarily utilized in asymmetric synthesis, particularly in catalytic processes where high enantioselectivity is required. It serves as a chiral ligand in transition metal-catalyzed reactions, such as hydrogenation, carbon-carbon bond formation, and other stereospecific transformations. Its unique structure, featuring biphenyl and bis(4-chlorophenyl)phosphine groups, allows it to effectively coordinate with metals like rhodium or iridium, enhancing the efficiency and selectivity of the catalytic system. Applications include the production of chiral pharmaceuticals, fine chemicals, and agrochemicals, where precise stereocontrol is critical. Its stability and ability to induce high enantiomeric excess make it a valuable tool in advanced organic synthesis.
Sizes / Availability / Pricing:
| Size | Availability | Price | Quantity |
|---|---|---|---|
| 0.050 G | 10-20 days | ฿18,756.00 |
+
-
|
| 0.010 G | 10-20 days | ฿4,698.00 |
+
-
|
1,1'-[(1R)-6,6'-Dimethoxy[1,1'-biphenyl]-2,2'-diyl]bis[1,1-bis(4-chlorophenyl)phosphine]
This chemical is primarily utilized in asymmetric synthesis, particularly in catalytic processes where high enantioselectivity is required. It serves as a chiral ligand in transition metal-catalyzed reactions, such as hydrogenation, carbon-carbon bond formation, and other stereospecific transformations. Its unique structure, featuring biphenyl and bis(4-chlorophenyl)phosphine groups, allows it to effectively coordinate with metals like rhodium or iridium, enhancing the efficiency and selectivity of the catalytic system. Applications include the production of chiral pharmaceuticals, fine chemicals, and agrochemicals, where precise stereocontrol is critical. Its stability and ability to induce high enantiomeric excess make it a valuable tool in advanced organic synthesis.
| Mechanism | - |
| Appearance | - |
| Longevity | - |
| Strength | - |
| Storage | - |
| Shelf Life | - |
| Allergen(s) | - |
| Dosage (Range) | - |
| Recommended Dosage | - |
| Dosage (Per Day) | - |
| Recommended Dosage (Per Day) | - |
| Mix Method | - |
| Heat Resistance | - |
| Stable in pH range | - |
| Solubility | - |
| Product Types | - |
| INCI | - |
Purchase History for
Loading purchase history...
Cart
No products
Subtotal:
฿0.00
฿0.00
Total :